![3,4-Dihydro-2H-pyrano[3,2-c]pyridine (CAS: 57446-02-3) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0681655.webp "3,4-Dihydro-2H-pyrano[3,2-c]pyridine chemical structure")
3,4-Dihydro-2H-pyrano[3,2-c]pyridine
Catalog No: FT-0681655
CAS No: 57446-02-3
- Chemical Name: 3,4-Dihydro-2H-pyrano[3,2-c]pyridine
- Molecular Formula: C8H9NO
- Molecular Weight: 135.16 g/mol
- InChI Key: PXFXRVCGZAGBRR-UHFFFAOYSA-N
- InChI: InChI=1S/C8H9NO/c1-2-7-6-9-4-3-8(7)10-5-1/h3-4,6H,1-2,5H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 135.16300 |
| Density: | N/A |
| CAS: | 57446-02-3 |
| Bolling_Point: | N/A |
| Product_Name: | 3,4-Dihydro-2H-pyrano[3,2-c]pyridine |
| Melting_Point: | N/A |
| Flash_Point: | N/A |
| MF: | C8H9NO |
| LogP: | 1.40660 |
|---|---|
| PSA: | 22.12000 |
| MF: | C8H9NO |
| FW: | 135.16300 |
| Exact_Mass: | 135.06800 |
| Warning_Statement: | P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934999090 |
